C23H17Cl2N3O7S4 — CID 25039023
[2-(3,5-dichloroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25039023) has the molecular formula C23H17Cl2N3O7S4 and a molecular weight of 646.58 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25039023 |
| Molecular Formula | C23H17Cl2N3O7S4 |
| Molecular Weight | 646.58 g/mol |
| Exact Mass | 644.93 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O7S4/c24-15-9-16(25)11-17(10-15)26-20(29)13-35-23(30)14-7-18(27-38(31,32)21-3-1-5-36-21)12-19(8-14)28-39(33,34)22-4-2-6-37-22/h1-12,27-28H,13H2,(H,26,29) |
| InChIKey | VKMFMOZARVJSBE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |