C21H22N2O7S4 — CID 25037570
(3,3-dimethyl-2-oxobutyl) 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25037570) has the molecular formula C21H22N2O7S4 and a molecular weight of 542.68 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25037570 |
| Molecular Formula | C21H22N2O7S4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H22N2O7S4/c1-21(2,3)17(24)13-30-20(25)14-10-15(22-33(26,27)18-6-4-8-31-18)12-16(11-14)23-34(28,29)19-7-5-9-32-19/h4-12,22-23H,13H2,1-3H3 |
| InChIKey | MFHWOUKCXXSOPL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |