C23H17FN4O9S4 — CID 25036748
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25036748) has the molecular formula C23H17FN4O9S4 and a molecular weight of 640.67 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25036748 |
| Molecular Formula | C23H17FN4O9S4 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 639.99 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17FN4O9S4/c24-18-6-5-15(12-19(18)28(31)32)25-20(29)13-37-23(30)14-9-16(26-40(33,34)21-3-1-7-38-21)11-17(10-14)27-41(35,36)22-4-2-8-39-22/h1-12,26-27H,13H2,(H,25,29) |
| InChIKey | RTHRKFSIIVOYAH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 190.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|