C20H14N4O7S2 — CID 4186820
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 4186820) has the molecular formula C20H14N4O7S2 and a molecular weight of 486.49 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 4186820 |
| Molecular Formula | C20H14N4O7S2 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H14N4O7S2/c21-11-14-10-16(24(27)28)7-8-17(14)22-18(25)12-31-20(26)13-3-5-15(6-4-13)23-33(29,30)19-2-1-9-32-19/h1-10,23H,12H2,(H,22,25) |
| InChIKey | DCSBTFDDPPRJRP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|