C12H11N3O6 — CID 7776210
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-methoxyacetate (PubChem CID 7776210) has the molecular formula C12H11N3O6 and a molecular weight of 293.24 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 7776210 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C12H11N3O6/c1-20-7-12(17)21-6-11(16)14-10-3-2-9(15(18)19)4-8(10)5-13/h2-4H,6-7H2,1H3,(H,14,16) |
| InChIKey | RRSZVEOOTCEALE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|