C16H9F2N3O5 — CID 7725827
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 7725827) has the molecular formula C16H9F2N3O5 and a molecular weight of 361.26 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 7725827 |
| Molecular Formula | C16H9F2N3O5 |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H9F2N3O5/c17-11-2-1-3-12(18)15(11)16(23)26-8-14(22)20-13-5-4-10(21(24)25)6-9(13)7-19/h1-6H,8H2,(H,20,22) |
| InChIKey | WKQAQOCQXLOUKW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|