C20H13N3O7 — CID 7228741
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7228741) has the molecular formula C20H13N3O7 and a molecular weight of 407.34 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7228741 |
| Molecular Formula | C20H13N3O7 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C20H13N3O7/c21-9-11-7-12(23(28)29)5-6-16(11)22-18(25)10-30-20(27)15-8-17(24)13-3-1-2-4-14(13)19(15)26/h1-8,24,26H,10H2,(H,22,25) |
| InChIKey | ZZPMATYIIWDGRM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 162.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|