C17H10F3N3O5 — CID 4618740
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 4618740) has the molecular formula C17H10F3N3O5 and a molecular weight of 393.28 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 4618740 |
| Molecular Formula | C17H10F3N3O5 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H10F3N3O5/c18-17(19,20)13-4-2-1-3-12(13)16(25)28-9-15(24)22-14-6-5-11(23(26)27)7-10(14)8-21/h1-7H,9H2,(H,22,24) |
| InChIKey | VEZRZJLIINDEDY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|