C16H11N3O6 — CID 3973412
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 3973412) has the molecular formula C16H11N3O6 and a molecular weight of 341.28 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 3973412 |
| Molecular Formula | C16H11N3O6 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H11N3O6/c17-8-11-7-12(19(23)24)3-6-14(11)18-15(21)9-25-16(22)10-1-4-13(20)5-2-10/h1-7,20H,9H2,(H,18,21) |
| InChIKey | WJKFLNBDKRCGGB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|