C18H15N3O5 — CID 7796135
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,4-dimethylbenzoate (PubChem CID 7796135) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7796135 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2C#N)c(C)c1 |
| InChI | InChI=1S/C18H15N3O5/c1-11-3-5-15(12(2)7-11)18(23)26-10-17(22)20-16-6-4-14(21(24)25)8-13(16)9-19/h3-8H,10H2,1-2H3,(H,20,22) |
| InChIKey | BQFHWJGLFNSBPE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|