C23H14N4O5S — CID 3978971
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 3978971) has the molecular formula C23H14N4O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3978971 |
| Molecular Formula | C23H14N4O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C23H14N4O5S/c24-12-14-10-15(27(30)31)7-8-18(14)26-22(28)13-32-23(29)17-11-20(21-6-3-9-33-21)25-19-5-2-1-4-16(17)19/h1-11H,13H2,(H,26,28) |
| InChIKey | ZBTPPHSDCYUXMX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|