C23H17N3O4S — CID 2119050
[2-(4-carbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 2119050) has the molecular formula C23H17N3O4S and a molecular weight of 431.47 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2119050 |
| Molecular Formula | C23H17N3O4S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)c2cc(-c3cccs3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H17N3O4S/c24-22(28)14-7-9-15(10-8-14)25-21(27)13-30-23(29)17-12-19(20-6-3-11-31-20)26-18-5-2-1-4-16(17)18/h1-12H,13H2,(H2,24,28)(H,25,27) |
| InChIKey | XLUUADNYHXLLFV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |