C24H19N3O5 — CID 2571407
[2-(4-carbamoylanilino)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate (PubChem CID 2571407) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2571407 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)Nc3ccc(C(N)=O)cc3)c3ccccc3n2)o1 |
| InChI | InChI=1S/C24H19N3O5/c1-14-6-11-21(32-14)20-12-18(17-4-2-3-5-19(17)27-20)24(30)31-13-22(28)26-16-9-7-15(8-10-16)23(25)29/h2-12H,13H2,1H3,(H2,25,29)(H,26,28) |
| InChIKey | ZOMXQOXDYGPXMU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |