C24H17F3N2O4 — CID 4853389
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate (PubChem CID 4853389) has the molecular formula C24H17F3N2O4 and a molecular weight of 454.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4853389 |
| Molecular Formula | C24H17F3N2O4 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)Nc3ccccc3C(F)(F)F)c3ccccc3n2)o1 |
| InChI | InChI=1S/C24H17F3N2O4/c1-14-10-11-21(33-14)20-12-16(15-6-2-4-8-18(15)28-20)23(31)32-13-22(30)29-19-9-5-3-7-17(19)24(25,26)27/h2-12H,13H2,1H3,(H,29,30) |
| InChIKey | XJZYMNRGAUQWAY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |