C22H16N2O4 — CID 2353514
(2-anilino-2-oxoethyl) 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2353514) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2353514 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1ccccc1 |
| InChI | InChI=1S/C22H16N2O4/c25-21(23-15-7-2-1-3-8-15)14-28-22(26)17-13-19(20-11-6-12-27-20)24-18-10-5-4-9-16(17)18/h1-13H,14H2,(H,23,25) |
| InChIKey | AFYYTEFAVRMRLM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |