C22H14F2N2O4 — CID 2466613
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2466613) has the molecular formula C22H14F2N2O4 and a molecular weight of 408.36 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2466613 |
| Molecular Formula | C22H14F2N2O4 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H14F2N2O4/c23-16-8-7-13(10-17(16)24)25-21(27)12-30-22(28)15-11-19(20-6-3-9-29-20)26-18-5-2-1-4-14(15)18/h1-11H,12H2,(H,25,27) |
| InChIKey | MKYJICUXOQTCJF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |