C28H20N2O5 — CID 16528750
[2-oxo-2-(2-phenoxyanilino)ethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 16528750) has the molecular formula C28H20N2O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyanilino)ethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16528750 |
| Molecular Formula | C28H20N2O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C28H20N2O5/c31-27(30-23-13-6-7-14-26(23)35-19-9-2-1-3-10-19)18-34-28(32)21-17-24(25-15-8-16-33-25)29-22-12-5-4-11-20(21)22/h1-17H,18H2,(H,30,31) |
| InChIKey | XFEKSKMQOYBJEX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |