C31H26N2O6 — CID 39967131
[2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 39967131) has the molecular formula C31H26N2O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 39967131 |
| Molecular Formula | C31H26N2O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | COc1ccc(C(NC(=O)COC(=O)c2cc(-c3ccco3)nc3ccccc23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H26N2O6/c1-36-22-13-9-20(10-14-22)30(21-11-15-23(37-2)16-12-21)33-29(34)19-39-31(35)25-18-27(28-8-5-17-38-28)32-26-7-4-3-6-24(25)26/h3-18,30H,19H2,1-2H3,(H,33,34) |
| InChIKey | CSJJPHCRLRGXNZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |