C23H19NO4 — CID 7825231
2-(4-methylphenoxy)ethyl 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 7825231) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | 2-(4-methylphenoxy)ethyl 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7825231 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(OCCOC(=O)c2cc(-c3ccco3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H19NO4/c1-16-8-10-17(11-9-16)26-13-14-28-23(25)19-15-21(22-7-4-12-27-22)24-20-6-3-2-5-18(19)20/h2-12,15H,13-14H2,1H3 |
| InChIKey | GPBMTKCIZJSCPU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|