C24H22N2O6S — CID 55442123
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 55442123) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 55442123 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOC(=O)c2cc(-c3ccco3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N2O6S/c1-26(2)33(28,29)18-11-9-17(10-12-18)30-14-15-32-24(27)20-16-22(23-8-5-13-31-23)25-21-7-4-3-6-19(20)21/h3-13,16H,14-15H2,1-2H3 |
| InChIKey | NBAQHTHBYNJYAC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|