C21H21N3O5 — CID 9330721
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 9330721) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 9330721 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C21H21N3O5/c1-2-9-22-19(25)12-23-20(26)13-29-21(27)15-11-17(18-8-5-10-28-18)24-16-7-4-3-6-14(15)16/h3-8,10-11H,2,9,12-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | BVPRAQZODBKWEF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |