C22H15ClN2O4 — CID 2337988
[2-(2-chloroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2337988) has the molecular formula C22H15ClN2O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2337988 |
| Molecular Formula | C22H15ClN2O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H15ClN2O4/c23-16-7-2-4-9-18(16)25-21(26)13-29-22(27)15-12-19(20-10-5-11-28-20)24-17-8-3-1-6-14(15)17/h1-12H,13H2,(H,25,26) |
| InChIKey | YMIJIQBWGVPZTP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |