C23H17FN2O4 — CID 8761833
[2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 8761833) has the molecular formula C23H17FN2O4 and a molecular weight of 404.40 g/mol. Its IUPAC name is [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 8761833 |
| Molecular Formula | C23H17FN2O4 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cc(-c3ccco3)nc3ccccc23)c(F)c1 |
| InChI | InChI=1S/C23H17FN2O4/c1-14-8-9-19(17(24)11-14)26-22(27)13-30-23(28)16-12-20(21-7-4-10-29-21)25-18-6-3-2-5-15(16)18/h2-12H,13H2,1H3,(H,26,27) |
| InChIKey | OXTQOQQICCIMSK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |