C26H23N3O5 — CID 2121133
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2121133) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2121133 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H23N3O5/c30-25(27-18-7-9-19(10-8-18)29-11-14-32-15-12-29)17-34-26(31)21-16-23(24-6-3-13-33-24)28-22-5-2-1-4-20(21)22/h1-10,13,16H,11-12,14-15,17H2,(H,27,30) |
| InChIKey | MBWPSWVHMJMQOL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|