C26H27N5O4 — CID 41404505
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 41404505) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 41404505 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | CC(C)n1ncc2c(C(=O)OCC(=O)Nc3ccc(N4CCCC4)cc3)cc(-c3ccco3)nc21 |
| InChI | InChI=1S/C26H27N5O4/c1-17(2)31-25-21(15-27-31)20(14-22(29-25)23-6-5-13-34-23)26(33)35-16-24(32)28-18-7-9-19(10-8-18)30-11-3-4-12-30/h5-10,13-15,17H,3-4,11-12,16H2,1-2H3,(H,28,32) |
| InChIKey | JLQHMCXSOFVNRJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|