C28H25N3O4 — CID 2358673
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate (PubChem CID 2358673) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2358673 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccccc2)nc2ccccc12)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H25N3O4/c32-27(29-21-10-12-22(13-11-21)31-14-16-34-17-15-31)19-35-28(33)24-18-26(20-6-2-1-3-7-20)30-25-9-5-4-8-23(24)25/h1-13,18H,14-17,19H2,(H,29,32) |
| InChIKey | QULNDMBGRZHHIK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|