C19H17ClF2N2O4 — CID 2417027
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2417027) has the molecular formula C19H17ClF2N2O4 and a molecular weight of 410.80 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2417027 |
| Molecular Formula | C19H17ClF2N2O4 |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H17ClF2N2O4/c20-15-10-17(22)16(21)9-14(15)19(26)28-11-18(25)23-12-1-3-13(4-2-12)24-5-7-27-8-6-24/h1-4,9-10H,5-8,11H2,(H,23,25) |
| InChIKey | BVDBCLCLUCDASY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|