C21H20ClFN2O4 — CID 7835235
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7835235) has the molecular formula C21H20ClFN2O4 and a molecular weight of 418.85 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7835235 |
| Molecular Formula | C21H20ClFN2O4 |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)c(Cl)c1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H20ClFN2O4/c22-18-13-15(1-7-19(18)23)2-8-21(27)29-14-20(26)24-16-3-5-17(6-4-16)25-9-11-28-12-10-25/h1-8,13H,9-12,14H2,(H,24,26)/b8-2+ |
| InChIKey | ZQIJAJGQPSKZEN-KRXBUXKQSA-N |
| XLogP | 3.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|