C14H11ClFNO5 — CID 8942774
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 8942774) has the molecular formula C14H11ClFNO5 and a molecular weight of 327.69 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8942774 |
| Molecular Formula | C14H11ClFNO5 |
| Molecular Weight | 327.69 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)OCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C14H11ClFNO5/c15-10-7-9(1-3-11(10)16)2-4-13(19)22-8-12(18)17-5-6-21-14(17)20/h1-4,7H,5-6,8H2/b4-2+ |
| InChIKey | FVWNJXBYVASGFK-DUXPYHPUSA-N |
| XLogP | 2.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|