C15H12N2O5 — CID 8935026
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(4-cyanophenyl)prop-2-enoate (PubChem CID 8935026) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(4-cyanophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(4-cyanophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8935026 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-3-(4-cyanophenyl)prop-2-enoate |
| SMILES | N#Cc1ccc(/C=C/C(=O)OCC(=O)N2CCOC2=O)cc1 |
| InChI | InChI=1S/C15H12N2O5/c16-9-12-3-1-11(2-4-12)5-6-14(19)22-10-13(18)17-7-8-21-15(17)20/h1-6H,7-8,10H2/b6-5+ |
| InChIKey | SEPUCIAMKGKJET-AATRIKPKSA-N |
| XLogP | 1.09 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|