C14H10N2O4 — CID 173062460
(2,5-dioxopyrrolidin-1-yl) (E)-3-(4-cyanophenyl)prop-2-enoate (PubChem CID 173062460) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (E)-3-(4-cyanophenyl)prop-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (E)-3-(4-cyanophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 173062460 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (E)-3-(4-cyanophenyl)prop-2-enoate |
| SMILES | N#Cc1ccc(/C=C/C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H10N2O4/c15-9-11-3-1-10(2-4-11)5-8-14(19)20-16-12(17)6-7-13(16)18/h1-5,8H,6-7H2/b8-5+ |
| InChIKey | GFASCVQEGDHEHM-VMPITWQZSA-N |
| XLogP | 1.18 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|