C15H15N3O2 — CID 76931950
4-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)prop-1-enyl]benzonitrile (PubChem CID 76931950) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)prop-1-enyl]benzonitrile.
| Compound Name | 4-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 76931950 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)prop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccc(C=CC(=O)N2CCNC(=O)CC2)cc1 |
| InChI | InChI=1S/C15H15N3O2/c16-11-13-3-1-12(2-4-13)5-6-15(20)18-9-7-14(19)17-8-10-18/h1-6H,7-10H2,(H,17,19) |
| InChIKey | WXYCXUADRDUWSX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|