C13H16N2O2S — CID 55152085
1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]-1,4-diazepan-5-one (PubChem CID 55152085) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 55152085 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]-1,4-diazepan-5-one |
| SMILES | Cc1ccsc1/C=C/C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C13H16N2O2S/c1-10-5-9-18-11(10)2-3-13(17)15-7-4-12(16)14-6-8-15/h2-3,5,9H,4,6-8H2,1H3,(H,14,16)/b3-2+ |
| InChIKey | HIXVGSKNHSUKHM-NSCUHMNNSA-N |
| XLogP | 1.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|