C9H14N2O2 — CID 63004581
1-[(E)-but-2-enoyl]-1,4-diazepan-5-one (PubChem CID 63004581) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-[(E)-but-2-enoyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(E)-but-2-enoyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63004581 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-[(E)-but-2-enoyl]-1,4-diazepan-5-one |
| SMILES | C/C=C/C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-9(13)11-6-4-8(12)10-5-7-11/h2-3H,4-7H2,1H3,(H,10,12)/b3-2+ |
| InChIKey | SVIADQGPYFMJBP-NSCUHMNNSA-N |
| XLogP | -0.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|