About 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione
1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione (PubChem CID 63002706) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione.
Molecular Properties
| Compound Name | 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione |
| PubChem CID | 63002706 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione |
| SMILES | O=C1CCN(C(=O)C(=O)N2CCNCC2)CCN1 |
| InChI | InChI=1S/C11H18N4O3/c16-9-1-5-14(8-4-13-9)10(17)11(18)15-6-2-12-3-7-15/h12H,1-8H2,(H,13,16) |
| InChIKey | ZAZJLBBWZGMQRQ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione?
The IUPAC name of 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione (CID 63002706) is 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione.
What is the SMILES notation for 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione?
The canonical SMILES for 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione is O=C1CCN(C(=O)C(=O)N2CCNCC2)CCN1.
What is the InChIKey of 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione?
The InChIKey is ZAZJLBBWZGMQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c16-9-1-5-14(8-4-13-9)10(17)11(18)15-6-2-12-3-7-15/h12H,1-8H2,(H,13,16).
What are the key properties of 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione?
1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione has a molecular weight of 254.29 g/mol, XLogP of -2.23, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-oxo-1,4-diazepan-1-yl)-2-piperazin-1-ylethane-1,2-dione is sourced from PubChem (CID 63002706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).