C12H20N4O3 — CID 28507184
1-(4-acetylpiperazin-1-yl)-2-piperazin-1-ylethane-1,2-dione (PubChem CID 28507184) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-piperazin-1-ylethane-1,2-dione.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-piperazin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 28507184 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-piperazin-1-ylethane-1,2-dione |
| SMILES | CC(=O)N1CCN(C(=O)C(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C12H20N4O3/c1-10(17)14-6-8-16(9-7-14)12(19)11(18)15-4-2-13-3-5-15/h13H,2-9H2,1H3 |
| InChIKey | OOBKTLYGUKXEER-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|