About ethene;1-piperazin-1-ylethanone
ethene;1-piperazin-1-ylethanone (PubChem CID 145071339) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is ethene;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | ethene;1-piperazin-1-ylethanone |
| PubChem CID | 145071339 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | ethene;1-piperazin-1-ylethanone |
| SMILES | C=C.CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C6H12N2O.C2H4/c1-6(9)8-4-2-7-3-5-8;1-2/h7H,2-5H2,1H3;1-2H2 |
| InChIKey | GWCMVUWUTGBLPM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-piperazin-1-ylethanone?
The IUPAC name of ethene;1-piperazin-1-ylethanone (CID 145071339) is ethene;1-piperazin-1-ylethanone.
What is the SMILES notation for ethene;1-piperazin-1-ylethanone?
The canonical SMILES for ethene;1-piperazin-1-ylethanone is C=C.CC(=O)N1CCNCC1.
What is the InChIKey of ethene;1-piperazin-1-ylethanone?
The InChIKey is GWCMVUWUTGBLPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2H4/c1-6(9)8-4-2-7-3-5-8;1-2/h7H,2-5H2,1H3;1-2H2.
What are the key properties of ethene;1-piperazin-1-ylethanone?
ethene;1-piperazin-1-ylethanone has a molecular weight of 156.23 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-piperazin-1-ylethanone is sourced from PubChem (CID 145071339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).