C12H20N4O2 — CID 141152573
(E)-1,4-di(piperazin-1-yl)but-2-ene-1,4-dione (PubChem CID 141152573) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is (E)-1,4-di(piperazin-1-yl)but-2-ene-1,4-dione.
| Compound Name | (E)-1,4-di(piperazin-1-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 141152573 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (E)-1,4-di(piperazin-1-yl)but-2-ene-1,4-dione |
| SMILES | O=C(/C=C/C(=O)N1CCNCC1)N1CCNCC1 |
| InChI | InChI=1S/C12H20N4O2/c17-11(15-7-3-13-4-8-15)1-2-12(18)16-9-5-14-6-10-16/h1-2,13-14H,3-10H2/b2-1+ |
| InChIKey | HIHUMSQDPFSQDZ-OWOJBTEDSA-N |
| XLogP | -1.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|