C13H14Cl2N2O — CID 39286283
(E)-3-(2,4-dichlorophenyl)-1-piperazin-1-ylprop-2-en-1-one (PubChem CID 39286283) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-piperazin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-piperazin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 39286283 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-piperazin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H14Cl2N2O/c14-11-3-1-10(12(15)9-11)2-4-13(18)17-7-5-16-6-8-17/h1-4,9,16H,5-8H2/b4-2+ |
| InChIKey | UZBXNEJEFJFXDV-DUXPYHPUSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|