C23H21Cl2NO4 — CID 41310449
(E)-3-(2,4-dichlorophenyl)-1-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 41310449) has the molecular formula C23H21Cl2NO4 and a molecular weight of 446.33 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 41310449 |
| Molecular Formula | C23H21Cl2NO4 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(c1ccc2c(c1)OCCO2)C1CCN(C(=O)/C=C/c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C23H21Cl2NO4/c24-18-4-1-15(19(25)14-18)3-6-22(27)26-9-7-16(8-10-26)23(28)17-2-5-20-21(13-17)30-12-11-29-20/h1-6,13-14,16H,7-12H2/b6-3+ |
| InChIKey | YEVYJUJUGMYOQW-ZZXKWVIFSA-N |
| XLogP | 4.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|