C17H19NO5 — CID 45427089
1-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylic acid (PubChem CID 45427089) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45427089 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)/C=C/c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C17H19NO5/c19-16(18-7-5-13(6-8-18)17(20)21)4-2-12-1-3-14-15(11-12)23-10-9-22-14/h1-4,11,13H,5-10H2,(H,20,21)/b4-2+ |
| InChIKey | WPOPBKLQTDPPOD-DUXPYHPUSA-N |
| XLogP | 1.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|