C18H21NO5 — CID 108754986
methyl 1-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108754986) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 1-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108754986 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl 1-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)/C=C\c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C18H21NO5/c1-22-18(21)14-6-8-19(9-7-14)17(20)5-3-13-2-4-15-16(12-13)24-11-10-23-15/h2-5,12,14H,6-11H2,1H3/b5-3- |
| InChIKey | YDJIVDWRTSVTNQ-HYXAFXHYSA-N |
| XLogP | 1.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|