C26H26N2O6 — CID 2171808
(Z)-3-(1,3-benzodioxol-5-yl)-N-[[1-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperidin-4-yl]methyl]prop-2-enamide (PubChem CID 2171808) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-[[1-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperidin-4-yl]methyl]prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-[[1-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 2171808 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-[[1-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperidin-4-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc2c(c1)OCO2)NCC1CCN(C(=O)/C=C\c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C26H26N2O6/c29-25(7-3-18-1-5-21-23(13-18)33-16-31-21)27-15-20-9-11-28(12-10-20)26(30)8-4-19-2-6-22-24(14-19)34-17-32-22/h1-8,13-14,20H,9-12,15-17H2,(H,27,29)/b7-3-,8-4- |
| InChIKey | WSMDVDYMDSXAJC-VHOZIDCHSA-N |
| XLogP | 3.23 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|