C17H20N2O5 — CID 881665
ethyl 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 881665) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 881665 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)/C=C/c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H20N2O5/c1-2-22-17(21)19-9-7-18(8-10-19)16(20)6-4-13-3-5-14-15(11-13)24-12-23-14/h3-6,11H,2,7-10,12H2,1H3/b6-4+ |
| InChIKey | DVAFKZUBFBISBT-GQCTYLIASA-N |
| XLogP | 1.73 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|