C12H12O3S — CID 6450715
O-ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enethioate (PubChem CID 6450715) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is O-ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enethioate.
| Compound Name | O-ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enethioate |
|---|---|
| PubChem CID | 6450715 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | O-ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enethioate |
| SMILES | CCOC(=S)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12O3S/c1-2-13-12(16)6-4-9-3-5-10-11(7-9)15-8-14-10/h3-7H,2,8H2,1H3/b6-4+ |
| InChIKey | SQYGWABCYSWYMD-GQCTYLIASA-N |
| XLogP | 2.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|