C17H13NO5 — CID 154605356
1-(6-amino-1,3-benzodioxol-5-yl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 154605356) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is 1-(6-amino-1,3-benzodioxol-5-yl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | 1-(6-amino-1,3-benzodioxol-5-yl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 154605356 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-(6-amino-1,3-benzodioxol-5-yl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | Nc1cc2c(cc1C(=O)C=Cc1ccc3c(c1)OCO3)OCO2 |
| InChI | InChI=1S/C17H13NO5/c18-12-7-17-16(22-9-23-17)6-11(12)13(19)3-1-10-2-4-14-15(5-10)21-8-20-14/h1-7H,8-9,18H2 |
| InChIKey | LICSTVQJOLSZLL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|