C16H11NO5 — CID 2781212
3-(1,3-benzodioxol-5-yl)-1-(2-nitrophenyl)prop-2-en-1-one (PubChem CID 2781212) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(2-nitrophenyl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2781212 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(2-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11NO5/c18-14(12-3-1-2-4-13(12)17(19)20)7-5-11-6-8-15-16(9-11)22-10-21-15/h1-9H,10H2 |
| InChIKey | JBPHVKCHXMKECM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|