C17H13NO6 — CID 89195200
4-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-2-nitrobenzoic acid (PubChem CID 89195200) has the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-2-nitrobenzoic acid.
| Compound Name | 4-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 89195200 |
| Molecular Formula | C17H13NO6 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-2-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/c2ccc3c(c2)OCCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13NO6/c19-17(20)13-5-3-11(9-14(13)18(21)22)1-2-12-4-6-15-16(10-12)24-8-7-23-15/h1-6,9-10H,7-8H2,(H,19,20)/b2-1+ |
| InChIKey | BBSOZPHWWSSYKE-OWOJBTEDSA-N |
| XLogP | 3.23 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|