C24H21BrN2O6 — CID 158871211
4-bromo-1-methyl-2-nitrobenzene;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 158871211) has the molecular formula C24H21BrN2O6 and a molecular weight of 513.34 g/mol. Its IUPAC name is 4-bromo-1-methyl-2-nitrobenzene;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 4-bromo-1-methyl-2-nitrobenzene;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 158871211 |
| Molecular Formula | C24H21BrN2O6 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 4-bromo-1-methyl-2-nitrobenzene;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1ccc(/C=C/c2ccc3c(c2)OCCO3)cc1[N+](=O)[O-].Cc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15NO4.C7H6BrNO2/c1-12-2-3-13(10-15(12)18(19)20)4-5-14-6-7-16-17(11-14)22-9-8-21-16;1-5-2-3-6(8)4-7(5)9(10)11/h2-7,10-11H,8-9H2,1H3;2-4H,1H3/b5-4+; |
| InChIKey | JBWDXYIVGABNBQ-FXRZFVDSSA-N |
| XLogP | 6.51 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|