C15H13BrN2O6S — CID 4824350
N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 4824350) has the molecular formula C15H13BrN2O6S and a molecular weight of 429.25 g/mol. Its IUPAC name is N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4824350 |
| Molecular Formula | C15H13BrN2O6S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc3c(cc2Br)OCCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13BrN2O6S/c1-9-2-3-10(6-13(9)18(19)20)25(21,22)17-12-8-15-14(7-11(12)16)23-4-5-24-15/h2-3,6-8,17H,4-5H2,1H3 |
| InChIKey | PNBNQCCNJWDEQT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|